C21H14Cl2O2S — CID 7701638
9H-fluoren-9-yl 2-(2,5-dichlorophenyl)sulfanylacetate (PubChem CID 7701638) has the molecular formula C21H14Cl2O2S and a molecular weight of 401.31 g/mol. Its IUPAC name is 9H-fluoren-9-yl 2-(2,5-dichlorophenyl)sulfanylacetate.
| Compound Name | 9H-fluoren-9-yl 2-(2,5-dichlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7701638 |
| Molecular Formula | C21H14Cl2O2S |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 9H-fluoren-9-yl 2-(2,5-dichlorophenyl)sulfanylacetate |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)OC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H14Cl2O2S/c22-13-9-10-18(23)19(11-13)26-12-20(24)25-21-16-7-3-1-5-14(16)15-6-2-4-8-17(15)21/h1-11,21H,12H2 |
| InChIKey | XNVCFFNGXXRRDQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |