C15H11Cl3N2O3S — CID 7701533
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate (PubChem CID 7701533) has the molecular formula C15H11Cl3N2O3S and a molecular weight of 405.69 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7701533 |
| Molecular Formula | C15H11Cl3N2O3S |
| Molecular Weight | 405.69 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1cc(Cl)ccc1Cl)Nc1cccnc1Cl |
| InChI | InChI=1S/C15H11Cl3N2O3S/c16-9-3-4-10(17)12(6-9)24-8-14(22)23-7-13(21)20-11-2-1-5-19-15(11)18/h1-6H,7-8H2,(H,20,21) |
| InChIKey | AJWKZIGREPQFLP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|