C17H12Cl2N2O3S — CID 7701692
[2-(2-cyanoanilino)-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate (PubChem CID 7701692) has the molecular formula C17H12Cl2N2O3S and a molecular weight of 395.27 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7701692 |
| Molecular Formula | C17H12Cl2N2O3S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate |
| SMILES | N#Cc1ccccc1NC(=O)COC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H12Cl2N2O3S/c18-12-5-6-13(19)15(7-12)25-10-17(23)24-9-16(22)21-14-4-2-1-3-11(14)8-20/h1-7H,9-10H2,(H,21,22) |
| InChIKey | ATUSNWXAKSUHLF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |