C16H13Cl2NO3S — CID 7701715
(2-anilino-2-oxoethyl) 2-(2,5-dichlorophenyl)sulfanylacetate (PubChem CID 7701715) has the molecular formula C16H13Cl2NO3S and a molecular weight of 370.26 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(2,5-dichlorophenyl)sulfanylacetate.
| Compound Name | (2-anilino-2-oxoethyl) 2-(2,5-dichlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7701715 |
| Molecular Formula | C16H13Cl2NO3S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(2,5-dichlorophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1cc(Cl)ccc1Cl)Nc1ccccc1 |
| InChI | InChI=1S/C16H13Cl2NO3S/c17-11-6-7-13(18)14(8-11)23-10-16(21)22-9-15(20)19-12-4-2-1-3-5-12/h1-8H,9-10H2,(H,19,20) |
| InChIKey | FSFPUJOQWYVVMD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |