C18H17Cl2NO4S — CID 7701704
[2-(2-ethoxyanilino)-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate (PubChem CID 7701704) has the molecular formula C18H17Cl2NO4S and a molecular weight of 414.31 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7701704 |
| Molecular Formula | C18H17Cl2NO4S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 2-(2,5-dichlorophenyl)sulfanylacetate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H17Cl2NO4S/c1-2-24-15-6-4-3-5-14(15)21-17(22)10-25-18(23)11-26-16-9-12(19)7-8-13(16)20/h3-9H,2,10-11H2,1H3,(H,21,22) |
| InChIKey | LGZSLSXKTAINIX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |