C19H19Cl2NO6S — CID 17260707
[2-(2-ethoxyanilino)-2-oxoethyl] 3-(2,5-dichlorophenyl)sulfonylpropanoate (PubChem CID 17260707) has the molecular formula C19H19Cl2NO6S and a molecular weight of 460.34 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 3-(2,5-dichlorophenyl)sulfonylpropanoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 3-(2,5-dichlorophenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 17260707 |
| Molecular Formula | C19H19Cl2NO6S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 3-(2,5-dichlorophenyl)sulfonylpropanoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)CCS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H19Cl2NO6S/c1-2-27-16-6-4-3-5-15(16)22-18(23)12-28-19(24)9-10-29(25,26)17-11-13(20)7-8-14(17)21/h3-8,11H,2,9-10,12H2,1H3,(H,22,23) |
| InChIKey | VCDZVDRFTJMHIL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |