About (4-phenylpiperidin-4-yl) 2-chloropropanoate
(4-phenylpiperidin-4-yl) 2-chloropropanoate (PubChem CID 167314944) has the molecular formula C14H18ClNO2
and a molecular weight of 267.76 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-chloropropanoate.
Molecular Properties
| Compound Name | (4-phenylpiperidin-4-yl) 2-chloropropanoate |
| PubChem CID | 167314944 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-chloropropanoate |
| SMILES | CC(Cl)C(=O)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C14H18ClNO2/c1-11(15)13(17)18-14(7-9-16-10-8-14)12-5-3-2-4-6-12/h2-6,11,16H,7-10H2,1H3 |
| InChIKey | OQJGOKCFPUJFBI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylpiperidin-4-yl) 2-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylpiperidin-4-yl) 2-chloropropanoate?
The IUPAC name of (4-phenylpiperidin-4-yl) 2-chloropropanoate (CID 167314944) is (4-phenylpiperidin-4-yl) 2-chloropropanoate.
What is the SMILES notation for (4-phenylpiperidin-4-yl) 2-chloropropanoate?
The canonical SMILES for (4-phenylpiperidin-4-yl) 2-chloropropanoate is CC(Cl)C(=O)OC1(c2ccccc2)CCNCC1.
What is the InChIKey of (4-phenylpiperidin-4-yl) 2-chloropropanoate?
The InChIKey is OQJGOKCFPUJFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO2/c1-11(15)13(17)18-14(7-9-16-10-8-14)12-5-3-2-4-6-12/h2-6,11,16H,7-10H2,1H3.
What are the key properties of (4-phenylpiperidin-4-yl) 2-chloropropanoate?
(4-phenylpiperidin-4-yl) 2-chloropropanoate has a molecular weight of 267.76 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylpiperidin-4-yl) 2-chloropropanoate is sourced from PubChem (CID 167314944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).