C19H29NO3 — CID 167315335
(4-phenylpiperidin-4-yl) 2-hydroxyoctanoate (PubChem CID 167315335) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 2-hydroxyoctanoate.
| Compound Name | (4-phenylpiperidin-4-yl) 2-hydroxyoctanoate |
|---|---|
| PubChem CID | 167315335 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 2-hydroxyoctanoate |
| SMILES | CCCCCCC(O)C(=O)OC1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C19H29NO3/c1-2-3-4-8-11-17(21)18(22)23-19(12-14-20-15-13-19)16-9-6-5-7-10-16/h5-7,9-10,17,20-21H,2-4,8,11-15H2,1H3 |
| InChIKey | VHPSRCQAXPTHHZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|