C56H60N2O4 — CID 170256727
[4-[3-[4-[1-oxo-3-phenyl-1-(4-phenylpiperidin-4-yl)oxypropan-2-yl]phenyl]phenyl]piperidin-4-yl] 4-(4-hexylphenyl)benzoate (PubChem CID 170256727) has the molecular formula C56H60N2O4 and a molecular weight of 825.11 g/mol. Its IUPAC name is [4-[3-[4-[1-oxo-3-phenyl-1-(4-phenylpiperidin-4-yl)oxypropan-2-yl]phenyl]phenyl]piperidin-4-yl] 4-(4-hexylphenyl)benzoate.
| Compound Name | [4-[3-[4-[1-oxo-3-phenyl-1-(4-phenylpiperidin-4-yl)oxypropan-2-yl]phenyl]phenyl]piperidin-4-yl] 4-(4-hexylphenyl)benzoate |
|---|---|
| PubChem CID | 170256727 |
| Molecular Formula | C56H60N2O4 |
| Molecular Weight | 825.11 g/mol |
| Exact Mass | 824.46 |
| IUPAC Name | [4-[3-[4-[1-oxo-3-phenyl-1-(4-phenylpiperidin-4-yl)oxypropan-2-yl]phenyl]phenyl]piperidin-4-yl] 4-(4-hexylphenyl)benzoate |
| SMILES | CCCCCCc1ccc(-c2ccc(C(=O)OC3(c4cccc(-c5ccc(C(Cc6ccccc6)C(=O)OC6(c7ccccc7)CCNCC6)cc5)c4)CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C56H60N2O4/c1-2-3-4-7-13-42-20-22-44(23-21-42)45-26-30-48(31-27-45)53(59)61-56(34-38-58-39-35-56)51-19-12-16-49(41-51)46-24-28-47(29-25-46)52(40-43-14-8-5-9-15-43)54(60)62-55(32-36-57-37-33-55)50-17-10-6-11-18-50/h5-6,8-12,14-31,41,52,57-58H,2-4,7,13,32-40H2,1H3 |
| InChIKey | XQCBDTGQICGOIF-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.11 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|