C33H42O3 — CID 123697326
methyl 3-[4-[(1S)-1-(6-phenylhexoxy)heptyl]phenyl]benzoate (PubChem CID 123697326) has the molecular formula C33H42O3 and a molecular weight of 486.70 g/mol. Its IUPAC name is methyl 3-[4-[(1S)-1-(6-phenylhexoxy)heptyl]phenyl]benzoate.
| Compound Name | methyl 3-[4-[(1S)-1-(6-phenylhexoxy)heptyl]phenyl]benzoate |
|---|---|
| PubChem CID | 123697326 |
| Molecular Formula | C33H42O3 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | methyl 3-[4-[(1S)-1-(6-phenylhexoxy)heptyl]phenyl]benzoate |
| SMILES | CCCCCC[C@H](OCCCCCCc1ccccc1)c1ccc(-c2cccc(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C33H42O3/c1-3-4-5-12-20-32(36-25-13-7-6-9-15-27-16-10-8-11-17-27)29-23-21-28(22-24-29)30-18-14-19-31(26-30)33(34)35-2/h8,10-11,14,16-19,21-24,26,32H,3-7,9,12-13,15,20,25H2,1-2H3/t32-/m0/s1 |
| InChIKey | OYEIEJVYAVIJGI-YTTGMZPUSA-N |
| XLogP | 8.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|