About 3-(4-butylphenyl)benzoic acid
3-(4-butylphenyl)benzoic acid (PubChem CID 2757303) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(4-butylphenyl)benzoic acid.
Molecular Properties
| Compound Name | 3-(4-butylphenyl)benzoic acid |
| PubChem CID | 2757303 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-(4-butylphenyl)benzoic acid |
| SMILES | CCCCc1ccc(-c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H18O2/c1-2-3-5-13-8-10-14(11-9-13)15-6-4-7-16(12-15)17(18)19/h4,6-12H,2-3,5H2,1H3,(H,18,19) |
| InChIKey | KRJPKNYPVCUAOC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-butylphenyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-butylphenyl)benzoic acid?
The IUPAC name of 3-(4-butylphenyl)benzoic acid (CID 2757303) is 3-(4-butylphenyl)benzoic acid.
What is the SMILES notation for 3-(4-butylphenyl)benzoic acid?
The canonical SMILES for 3-(4-butylphenyl)benzoic acid is CCCCc1ccc(-c2cccc(C(=O)O)c2)cc1.
What is the InChIKey of 3-(4-butylphenyl)benzoic acid?
The InChIKey is KRJPKNYPVCUAOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2/c1-2-3-5-13-8-10-14(11-9-13)15-6-4-7-16(12-15)17(18)19/h4,6-12H,2-3,5H2,1H3,(H,18,19).
What are the key properties of 3-(4-butylphenyl)benzoic acid?
3-(4-butylphenyl)benzoic acid has a molecular weight of 254.33 g/mol, XLogP of 4.39, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-butylphenyl)benzoic acid is sourced from PubChem (CID 2757303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).