C20H20ClN3O2 — CID 19903422
3-[4-[(3-butyl-5-chloro-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 19903422) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 3-[4-[(3-butyl-5-chloro-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 3-[4-[(3-butyl-5-chloro-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19903422 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[4-[(3-butyl-5-chloro-1,2,4-triazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCc1nc(Cl)n(Cc2ccc(-c3cccc(C(=O)O)c3)cc2)n1 |
| InChI | InChI=1S/C20H20ClN3O2/c1-2-3-7-18-22-20(21)24(23-18)13-14-8-10-15(11-9-14)16-5-4-6-17(12-16)19(25)26/h4-6,8-12H,2-3,7,13H2,1H3,(H,25,26) |
| InChIKey | YJTOUCSVZNORBH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |