About 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid
1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid (PubChem CID 174363504) has the molecular formula C28H27ClN2O3
and a molecular weight of 474.99 g/mol. Its IUPAC name is 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid |
| PubChem CID | 174363504 |
| Molecular Formula | C28H27ClN2O3 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid |
| SMILES | CCCCCl.O=Cc1cncn1Cc1ccc(-c2cccc(-c3cccc(C(=O)O)c3)c2)cc1 |
| InChI | InChI=1S/C24H18N2O3.C4H9Cl/c27-15-23-13-25-16-26(23)14-17-7-9-18(10-8-17)19-3-1-4-20(11-19)21-5-2-6-22(12-21)24(28)29;1-2-3-4-5/h1-13,15-16H,14H2,(H,28,29);2-4H2,1H3 |
| InChIKey | DYCYXKSZPVVPLJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid?
The IUPAC name of 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid (CID 174363504) is 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid.
What is the SMILES notation for 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid?
The canonical SMILES for 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid is CCCCCl.O=Cc1cncn1Cc1ccc(-c2cccc(-c3cccc(C(=O)O)c3)c2)cc1.
What is the InChIKey of 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid?
The InChIKey is DYCYXKSZPVVPLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O3.C4H9Cl/c27-15-23-13-25-16-26(23)14-17-7-9-18(10-8-17)19-3-1-4-20(11-19)21-5-2-6-22(12-21)24(28)29;1-2-3-4-5/h1-13,15-16H,14H2,(H,28,29);2-4H2,1H3.
What are the key properties of 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid?
1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid has a molecular weight of 474.99 g/mol, XLogP of 6.80, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorobutane;3-[3-[4-[(5-formylimidazol-1-yl)methyl]phenyl]phenyl]benzoic acid is sourced from PubChem (CID 174363504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).