C24H25F2N3O2 — CID 19904116
3-[4-[[5-[(E)-but-2-enyl]-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 19904116) has the molecular formula C24H25F2N3O2 and a molecular weight of 425.48 g/mol. Its IUPAC name is 3-[4-[[5-[(E)-but-2-enyl]-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 3-[4-[[5-[(E)-but-2-enyl]-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19904116 |
| Molecular Formula | C24H25F2N3O2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[4-[[5-[(E)-but-2-enyl]-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | C/C=C/Cc1nc(C(F)(F)CCC)nn1Cc1ccc(-c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H25F2N3O2/c1-3-5-9-21-27-23(24(25,26)14-4-2)28-29(21)16-17-10-12-18(13-11-17)19-7-6-8-20(15-19)22(30)31/h3,5-8,10-13,15H,4,9,14,16H2,1-2H3,(H,30,31)/b5-3+ |
| InChIKey | IGUBVPBDGSRNGW-HWKANZROSA-N |
| XLogP | 5.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|