C25H27F2N7 — CID 54022617
5-[3-[[4-[[5-but-2-enyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole (PubChem CID 54022617) has the molecular formula C25H27F2N7 and a molecular weight of 463.54 g/mol. Its IUPAC name is 5-[3-[[4-[[5-but-2-enyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[3-[[4-[[5-but-2-enyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 54022617 |
| Molecular Formula | C25H27F2N7 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 5-[3-[[4-[[5-but-2-enyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole |
| SMILES | CC=CCc1nc(C(F)(F)CCC)nn1Cc1ccc(Cc2cccc(-c3nn[nH]n3)c2)cc1 |
| InChI | InChI=1S/C25H27F2N7/c1-3-5-9-22-28-24(25(26,27)14-4-2)31-34(22)17-19-12-10-18(11-13-19)15-20-7-6-8-21(16-20)23-29-32-33-30-23/h3,5-8,10-13,16H,4,9,14-15,17H2,1-2H3,(H,29,30,32,33) |
| InChIKey | KZYWKEHYVACVOZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|