C21H19N7S — CID 54181667
5-but-2-enyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carbothialdehyde (PubChem CID 54181667) has the molecular formula C21H19N7S and a molecular weight of 401.50 g/mol. Its IUPAC name is 5-but-2-enyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carbothialdehyde.
| Compound Name | 5-but-2-enyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carbothialdehyde |
|---|---|
| PubChem CID | 54181667 |
| Molecular Formula | C21H19N7S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 5-but-2-enyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazole-3-carbothialdehyde |
| SMILES | CC=CCc1nc(C=S)nn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C21H19N7S/c1-2-3-8-20-22-19(14-29)25-28(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)21-23-26-27-24-21/h2-7,9-12,14H,8,13H2,1H3,(H,23,24,26,27) |
| InChIKey | PCFVNWNOJIXDGP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|