C24H25N7 — CID 19903694
5-[3-[4-[[3,5-bis[(E)-but-2-enyl]-1,2,4-triazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 19903694) has the molecular formula C24H25N7 and a molecular weight of 411.51 g/mol. Its IUPAC name is 5-[3-[4-[[3,5-bis[(E)-but-2-enyl]-1,2,4-triazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[3-[4-[[3,5-bis[(E)-but-2-enyl]-1,2,4-triazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19903694 |
| Molecular Formula | C24H25N7 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 5-[3-[4-[[3,5-bis[(E)-but-2-enyl]-1,2,4-triazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | C/C=C/Cc1nc(C/C=C/C)n(Cc2ccc(-c3cccc(-c4nn[nH]n4)c3)cc2)n1 |
| InChI | InChI=1S/C24H25N7/c1-3-5-10-22-25-23(11-6-4-2)31(28-22)17-18-12-14-19(15-13-18)20-8-7-9-21(16-20)24-26-29-30-27-24/h3-9,12-16H,10-11,17H2,1-2H3,(H,26,27,29,30)/b5-3+,6-4+ |
| InChIKey | XWMCTIXYOPSTKO-GGWOSOGESA-N |
| XLogP | 4.41 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|