C21H21N7S — CID 19903802
2-[5-propyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethanethial (PubChem CID 19903802) has the molecular formula C21H21N7S and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-[5-propyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethanethial.
| Compound Name | 2-[5-propyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethanethial |
|---|---|
| PubChem CID | 19903802 |
| Molecular Formula | C21H21N7S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[5-propyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethanethial |
| SMILES | CCCc1nc(CC=S)nn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C21H21N7S/c1-2-5-20-22-19(12-13-29)25-28(20)14-15-8-10-16(11-9-15)17-6-3-4-7-18(17)21-23-26-27-24-21/h3-4,6-11,13H,2,5,12,14H2,1H3,(H,23,24,26,27) |
| InChIKey | SEVWYUMYZUMYLA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|