C26H33N7 — CID 19903608
5-[2-[4-[(3,5-dipentyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 19903608) has the molecular formula C26H33N7 and a molecular weight of 443.60 g/mol. Its IUPAC name is 5-[2-[4-[(3,5-dipentyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[(3,5-dipentyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19903608 |
| Molecular Formula | C26H33N7 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 5-[2-[4-[(3,5-dipentyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCCCCc1nc(CCCCC)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C26H33N7/c1-3-5-7-13-24-27-25(14-8-6-4-2)33(30-24)19-20-15-17-21(18-16-20)22-11-9-10-12-23(22)26-28-31-32-29-26/h9-12,15-18H,3-8,13-14,19H2,1-2H3,(H,28,29,31,32) |
| InChIKey | BDCKGTKJEKEFDM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|