C23H28N8 — CID 19976511
3-[4-[(3-pentyl-5-propyl-1,2,4-triazol-1-yl)methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine (PubChem CID 19976511) has the molecular formula C23H28N8 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-[4-[(3-pentyl-5-propyl-1,2,4-triazol-1-yl)methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 3-[4-[(3-pentyl-5-propyl-1,2,4-triazol-1-yl)methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 19976511 |
| Molecular Formula | C23H28N8 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 3-[4-[(3-pentyl-5-propyl-1,2,4-triazol-1-yl)methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCCCc1nc(CCC)n(Cc2ccc(-c3cccnc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C23H28N8/c1-3-5-6-10-20-25-21(8-4-2)31(28-20)16-17-11-13-18(14-12-17)19-9-7-15-24-22(19)23-26-29-30-27-23/h7,9,11-15H,3-6,8,10,16H2,1-2H3,(H,26,27,29,30) |
| InChIKey | MYKYMTQHRYHWSN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|