C24H30N8O2 — CID 19976361
3-[4-[[5-butyl-3-(1,1-dimethoxypropyl)-1,2,4-triazol-1-yl]methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine (PubChem CID 19976361) has the molecular formula C24H30N8O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 3-[4-[[5-butyl-3-(1,1-dimethoxypropyl)-1,2,4-triazol-1-yl]methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 3-[4-[[5-butyl-3-(1,1-dimethoxypropyl)-1,2,4-triazol-1-yl]methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 19976361 |
| Molecular Formula | C24H30N8O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 3-[4-[[5-butyl-3-(1,1-dimethoxypropyl)-1,2,4-triazol-1-yl]methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCCc1nc(C(CC)(OC)OC)nn1Cc1ccc(-c2cccnc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C24H30N8O2/c1-5-7-10-20-26-23(24(6-2,33-3)34-4)29-32(20)16-17-11-13-18(14-12-17)19-9-8-15-25-21(19)22-27-30-31-28-22/h8-9,11-15H,5-7,10,16H2,1-4H3,(H,27,28,30,31) |
| InChIKey | CMNPLDUNQDBCKL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|