C26H26N8 — CID 19976795
2-[4-[(5-pentyl-3-phenyl-1,2,4-triazol-1-yl)methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine (PubChem CID 19976795) has the molecular formula C26H26N8 and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-[4-[(5-pentyl-3-phenyl-1,2,4-triazol-1-yl)methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 2-[4-[(5-pentyl-3-phenyl-1,2,4-triazol-1-yl)methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 19976795 |
| Molecular Formula | C26H26N8 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[4-[(5-pentyl-3-phenyl-1,2,4-triazol-1-yl)methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCCCc1nc(-c2ccccc2)nn1Cc1ccc(-c2ncccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C26H26N8/c1-2-3-5-12-23-28-25(21-9-6-4-7-10-21)31-34(23)18-19-13-15-20(16-14-19)24-22(11-8-17-27-24)26-29-32-33-30-26/h4,6-11,13-17H,2-3,5,12,18H2,1H3,(H,29,30,32,33) |
| InChIKey | CPZPBJIPIKPLFW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|