C21H24N8 — CID 18700732
2-[4-[(5-methyl-2-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine (PubChem CID 18700732) has the molecular formula C21H24N8 and a molecular weight of 388.48 g/mol. Its IUPAC name is 2-[4-[(5-methyl-2-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 2-[4-[(5-methyl-2-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 18700732 |
| Molecular Formula | C21H24N8 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2-[4-[(5-methyl-2-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCCCn1nc(C)nc1Cc1ccc(-c2ncccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C21H24N8/c1-3-4-5-13-29-19(23-15(2)26-29)14-16-8-10-17(11-9-16)20-18(7-6-12-22-20)21-24-27-28-25-21/h6-12H,3-5,13-14H2,1-2H3,(H,24,25,27,28) |
| InChIKey | WGXOJFUQAQDGNY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|