C28H28N8O — CID 18700583
1-[1-pentyl-5-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]-2-phenylethanone (PubChem CID 18700583) has the molecular formula C28H28N8O and a molecular weight of 492.59 g/mol. Its IUPAC name is 1-[1-pentyl-5-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]-2-phenylethanone.
| Compound Name | 1-[1-pentyl-5-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 18700583 |
| Molecular Formula | C28H28N8O |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 1-[1-pentyl-5-[[4-[3-(2H-tetrazol-5-yl)-2-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]-2-phenylethanone |
| SMILES | CCCCCn1nc(C(=O)Cc2ccccc2)nc1Cc1ccc(-c2ncccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H28N8O/c1-2-3-7-17-36-25(30-28(33-36)24(37)18-20-9-5-4-6-10-20)19-21-12-14-22(15-13-21)26-23(11-8-16-29-26)27-31-34-35-32-27/h4-6,8-16H,2-3,7,17-19H2,1H3,(H,31,32,34,35) |
| InChIKey | DRCNUGZKLGKVFV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|