C24H28N8O — CID 18701154
1-[1-pentyl-5-[[5-[2-(2H-tetrazol-5-yl)phenyl]-2-pyridinyl]methyl]-1,2,4-triazol-3-yl]butan-1-one (PubChem CID 18701154) has the molecular formula C24H28N8O and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-[1-pentyl-5-[[5-[2-(2H-tetrazol-5-yl)phenyl]-2-pyridinyl]methyl]-1,2,4-triazol-3-yl]butan-1-one.
| Compound Name | 1-[1-pentyl-5-[[5-[2-(2H-tetrazol-5-yl)phenyl]-2-pyridinyl]methyl]-1,2,4-triazol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 18701154 |
| Molecular Formula | C24H28N8O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 1-[1-pentyl-5-[[5-[2-(2H-tetrazol-5-yl)phenyl]-2-pyridinyl]methyl]-1,2,4-triazol-3-yl]butan-1-one |
| SMILES | CCCCCn1nc(C(=O)CCC)nc1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cn1 |
| InChI | InChI=1S/C24H28N8O/c1-3-5-8-14-32-22(26-24(29-32)21(33)9-4-2)15-18-13-12-17(16-25-18)19-10-6-7-11-20(19)23-27-30-31-28-23/h6-7,10-13,16H,3-5,8-9,14-15H2,1-2H3,(H,27,28,30,31) |
| InChIKey | RGFAVKIZASXCDT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|