C25H30N8O — CID 18700905
1-[1-pentyl-5-[[4-[3-(2H-tetrazol-5-yl)-4-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]pentan-1-one (PubChem CID 18700905) has the molecular formula C25H30N8O and a molecular weight of 458.57 g/mol. Its IUPAC name is 1-[1-pentyl-5-[[4-[3-(2H-tetrazol-5-yl)-4-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]pentan-1-one.
| Compound Name | 1-[1-pentyl-5-[[4-[3-(2H-tetrazol-5-yl)-4-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 18700905 |
| Molecular Formula | C25H30N8O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 1-[1-pentyl-5-[[4-[3-(2H-tetrazol-5-yl)-4-pyridinyl]phenyl]methyl]-1,2,4-triazol-3-yl]pentan-1-one |
| SMILES | CCCCCn1nc(C(=O)CCCC)nc1Cc1ccc(-c2ccncc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H30N8O/c1-3-5-7-15-33-23(27-25(30-33)22(34)8-6-4-2)16-18-9-11-19(12-10-18)20-13-14-26-17-21(20)24-28-31-32-29-24/h9-14,17H,3-8,15-16H2,1-2H3,(H,28,29,31,32) |
| InChIKey | CMUQBNXZMRIMRQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|