C25H32N8 — CID 18701260
3-[4-[(2,5-dipentyl-1,2,4-triazol-3-yl)methyl]phenyl]-4-(2H-tetrazol-5-yl)pyridine (PubChem CID 18701260) has the molecular formula C25H32N8 and a molecular weight of 444.59 g/mol. Its IUPAC name is 3-[4-[(2,5-dipentyl-1,2,4-triazol-3-yl)methyl]phenyl]-4-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 3-[4-[(2,5-dipentyl-1,2,4-triazol-3-yl)methyl]phenyl]-4-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 18701260 |
| Molecular Formula | C25H32N8 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 3-[4-[(2,5-dipentyl-1,2,4-triazol-3-yl)methyl]phenyl]-4-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCCCc1nc(Cc2ccc(-c3cnccc3-c3nn[nH]n3)cc2)n(CCCCC)n1 |
| InChI | InChI=1S/C25H32N8/c1-3-5-7-9-23-27-24(33(30-23)16-8-6-4-2)17-19-10-12-20(13-11-19)22-18-26-15-14-21(22)25-28-31-32-29-25/h10-15,18H,3-9,16-17H2,1-2H3,(H,28,29,31,32) |
| InChIKey | NCDJWUDHDXJQNC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|