C22H26N8 — CID 18701424
5-[(5-ethyl-2-pentyl-1,2,4-triazol-3-yl)methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine (PubChem CID 18701424) has the molecular formula C22H26N8 and a molecular weight of 402.51 g/mol. Its IUPAC name is 5-[(5-ethyl-2-pentyl-1,2,4-triazol-3-yl)methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine.
| Compound Name | 5-[(5-ethyl-2-pentyl-1,2,4-triazol-3-yl)methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 18701424 |
| Molecular Formula | C22H26N8 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 5-[(5-ethyl-2-pentyl-1,2,4-triazol-3-yl)methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine |
| SMILES | CCCCCn1nc(CC)nc1Cc1ccc(-c2ccccc2-c2nn[nH]n2)nc1 |
| InChI | InChI=1S/C22H26N8/c1-3-5-8-13-30-21(24-20(4-2)27-30)14-16-11-12-19(23-15-16)17-9-6-7-10-18(17)22-25-28-29-26-22/h6-7,9-12,15H,3-5,8,13-14H2,1-2H3,(H,25,26,28,29) |
| InChIKey | ULAUJDKDHBQPHU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|