C27H28N8 — CID 19976374
5-[(3-benzyl-5-pentyl-1,2,4-triazol-1-yl)methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine (PubChem CID 19976374) has the molecular formula C27H28N8 and a molecular weight of 464.58 g/mol. Its IUPAC name is 5-[(3-benzyl-5-pentyl-1,2,4-triazol-1-yl)methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine.
| Compound Name | 5-[(3-benzyl-5-pentyl-1,2,4-triazol-1-yl)methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 19976374 |
| Molecular Formula | C27H28N8 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 5-[(3-benzyl-5-pentyl-1,2,4-triazol-1-yl)methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine |
| SMILES | CCCCCc1nc(Cc2ccccc2)nn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)nc1 |
| InChI | InChI=1S/C27H28N8/c1-2-3-5-14-26-29-25(17-20-10-6-4-7-11-20)32-35(26)19-21-15-16-24(28-18-21)22-12-8-9-13-23(22)27-30-33-34-31-27/h4,6-13,15-16,18H,2-3,5,14,17,19H2,1H3,(H,30,31,33,34) |
| InChIKey | SZEDCSMDKYFYSB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|