C27H34N8 — CID 19976395
5-[[3-(cyclohexylmethyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine (PubChem CID 19976395) has the molecular formula C27H34N8 and a molecular weight of 470.63 g/mol. Its IUPAC name is 5-[[3-(cyclohexylmethyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine.
| Compound Name | 5-[[3-(cyclohexylmethyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 19976395 |
| Molecular Formula | C27H34N8 |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 5-[[3-(cyclohexylmethyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]-2-[2-(2H-tetrazol-5-yl)phenyl]pyridine |
| SMILES | CCCCCc1nc(CC2CCCCC2)nn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)nc1 |
| InChI | InChI=1S/C27H34N8/c1-2-3-5-14-26-29-25(17-20-10-6-4-7-11-20)32-35(26)19-21-15-16-24(28-18-21)22-12-8-9-13-23(22)27-30-33-34-31-27/h8-9,12-13,15-16,18,20H,2-7,10-11,14,17,19H2,1H3,(H,30,31,33,34) |
| InChIKey | DXTFRJDPJUWARW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|