C28H30N8 — CID 19976816
3-[4-[[5-pentyl-3-(2-phenylethyl)-1,2,4-triazol-1-yl]methyl]phenyl]-4-(2H-tetrazol-5-yl)pyridine (PubChem CID 19976816) has the molecular formula C28H30N8 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-[4-[[5-pentyl-3-(2-phenylethyl)-1,2,4-triazol-1-yl]methyl]phenyl]-4-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 3-[4-[[5-pentyl-3-(2-phenylethyl)-1,2,4-triazol-1-yl]methyl]phenyl]-4-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 19976816 |
| Molecular Formula | C28H30N8 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 3-[4-[[5-pentyl-3-(2-phenylethyl)-1,2,4-triazol-1-yl]methyl]phenyl]-4-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCCCc1nc(CCc2ccccc2)nn1Cc1ccc(-c2cnccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H30N8/c1-2-3-5-10-27-30-26(16-13-21-8-6-4-7-9-21)33-36(27)20-22-11-14-23(15-12-22)25-19-29-18-17-24(25)28-31-34-35-32-28/h4,6-9,11-12,14-15,17-19H,2-3,5,10,13,16,20H2,1H3,(H,31,32,34,35) |
| InChIKey | KBXAPXZZRWVEFA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|