C23H27N7 — CID 19903876
5-[2-[4-[(5-ethyl-3-pentyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 19903876) has the molecular formula C23H27N7 and a molecular weight of 401.52 g/mol. Its IUPAC name is 5-[2-[4-[(5-ethyl-3-pentyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[(5-ethyl-3-pentyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19903876 |
| Molecular Formula | C23H27N7 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 5-[2-[4-[(5-ethyl-3-pentyl-1,2,4-triazol-1-yl)methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCCCCc1nc(CC)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C23H27N7/c1-3-5-6-11-21-24-22(4-2)30(27-21)16-17-12-14-18(15-13-17)19-9-7-8-10-20(19)23-25-28-29-26-23/h7-10,12-15H,3-6,11,16H2,1-2H3,(H,25,26,28,29) |
| InChIKey | JZJVJYXOJSFGCB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|