C25H31N7 — CID 19750672
5-[2-[4-[(2-tert-butyl-5-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 19750672) has the molecular formula C25H31N7 and a molecular weight of 429.57 g/mol. Its IUPAC name is 5-[2-[4-[(2-tert-butyl-5-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[(2-tert-butyl-5-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19750672 |
| Molecular Formula | C25H31N7 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 5-[2-[4-[(2-tert-butyl-5-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCCCCc1nc(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C25H31N7/c1-5-6-7-12-22-26-23(32(29-22)25(2,3)4)17-18-13-15-19(16-14-18)20-10-8-9-11-21(20)24-27-30-31-28-24/h8-11,13-16H,5-7,12,17H2,1-4H3,(H,27,28,30,31) |
| InChIKey | NURWYWSZAMBCTC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|