C29H37N7 — CID 19750491
5-[2-[4-[[5-(2-cyclohexylethyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 19750491) has the molecular formula C29H37N7 and a molecular weight of 483.66 g/mol. Its IUPAC name is 5-[2-[4-[[5-(2-cyclohexylethyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[[5-(2-cyclohexylethyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19750491 |
| Molecular Formula | C29H37N7 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 5-[2-[4-[[5-(2-cyclohexylethyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCCCCn1nc(CCC2CCCCC2)nc1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C29H37N7/c1-2-3-9-20-36-28(30-27(33-36)19-16-22-10-5-4-6-11-22)21-23-14-17-24(18-15-23)25-12-7-8-13-26(25)29-31-34-35-32-29/h7-8,12-15,17-18,22H,2-6,9-11,16,19-21H2,1H3,(H,31,32,34,35) |
| InChIKey | CNNRXTPCISSFTQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|