C25H30N4O3 — CID 18700846
2-[6-[(5-pentanoyl-2-pentyl-1,2,4-triazol-3-yl)methyl]-3-pyridinyl]benzoic acid (PubChem CID 18700846) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[6-[(5-pentanoyl-2-pentyl-1,2,4-triazol-3-yl)methyl]-3-pyridinyl]benzoic acid.
| Compound Name | 2-[6-[(5-pentanoyl-2-pentyl-1,2,4-triazol-3-yl)methyl]-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 18700846 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-[6-[(5-pentanoyl-2-pentyl-1,2,4-triazol-3-yl)methyl]-3-pyridinyl]benzoic acid |
| SMILES | CCCCCn1nc(C(=O)CCCC)nc1Cc1ccc(-c2ccccc2C(=O)O)cn1 |
| InChI | InChI=1S/C25H30N4O3/c1-3-5-9-15-29-23(27-24(28-29)22(30)12-6-4-2)16-19-14-13-18(17-26-19)20-10-7-8-11-21(20)25(31)32/h7-8,10-11,13-14,17H,3-6,9,12,15-16H2,1-2H3,(H,31,32) |
| InChIKey | GMYNIBZTAJZBMO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|