C23H26N4O3 — CID 18701342
2-[4-[(2-pentyl-5-propanoyl-1,2,4-triazol-3-yl)methyl]phenyl]pyridine-3-carboxylic acid (PubChem CID 18701342) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[4-[(2-pentyl-5-propanoyl-1,2,4-triazol-3-yl)methyl]phenyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[4-[(2-pentyl-5-propanoyl-1,2,4-triazol-3-yl)methyl]phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18701342 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-[4-[(2-pentyl-5-propanoyl-1,2,4-triazol-3-yl)methyl]phenyl]pyridine-3-carboxylic acid |
| SMILES | CCCCCn1nc(C(=O)CC)nc1Cc1ccc(-c2ncccc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H26N4O3/c1-3-5-6-14-27-20(25-22(26-27)19(28)4-2)15-16-9-11-17(12-10-16)21-18(23(29)30)8-7-13-24-21/h7-13H,3-6,14-15H2,1-2H3,(H,29,30) |
| InChIKey | VFPVGLFWWSMBBT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|