C24H28F2N8 — CID 18700964
2-[4-[[5-(1,1-difluorobutyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine (PubChem CID 18700964) has the molecular formula C24H28F2N8 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[4-[[5-(1,1-difluorobutyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 2-[4-[[5-(1,1-difluorobutyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 18700964 |
| Molecular Formula | C24H28F2N8 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-[4-[[5-(1,1-difluorobutyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCCCn1nc(C(F)(F)CCC)nc1Cc1ccc(-c2ncccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C24H28F2N8/c1-3-5-6-15-34-20(28-23(31-34)24(25,26)13-4-2)16-17-9-11-18(12-10-17)21-19(8-7-14-27-21)22-29-32-33-30-22/h7-12,14H,3-6,13,15-16H2,1-2H3,(H,29,30,32,33) |
| InChIKey | MWUUWDGVIBFRPL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|