C23H28N8 — CID 18700865
3-[4-[(2-pentyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine (PubChem CID 18700865) has the molecular formula C23H28N8 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-[4-[(2-pentyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 3-[4-[(2-pentyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 18700865 |
| Molecular Formula | C23H28N8 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 3-[4-[(2-pentyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]phenyl]-2-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCCCn1nc(C(C)C)nc1Cc1ccc(-c2cccnc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C23H28N8/c1-4-5-6-14-31-20(25-22(28-31)16(2)3)15-17-9-11-18(12-10-17)19-8-7-13-24-21(19)23-26-29-30-27-23/h7-13,16H,4-6,14-15H2,1-3H3,(H,26,27,29,30) |
| InChIKey | CQBZDMDBAQTJCF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|