C26H31F2N7 — CID 19904206
5-[2-[[4-[[3-(1,1-difluorobutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole (PubChem CID 19904206) has the molecular formula C26H31F2N7 and a molecular weight of 479.58 g/mol. Its IUPAC name is 5-[2-[[4-[[3-(1,1-difluorobutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[[4-[[3-(1,1-difluorobutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19904206 |
| Molecular Formula | C26H31F2N7 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 5-[2-[[4-[[3-(1,1-difluorobutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole |
| SMILES | CCCCCc1nc(C(F)(F)CCC)nn1Cc1ccc(Cc2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C26H31F2N7/c1-3-5-6-11-23-29-25(26(27,28)16-4-2)32-35(23)18-20-14-12-19(13-15-20)17-21-9-7-8-10-22(21)24-30-33-34-31-24/h7-10,12-15H,3-6,11,16-18H2,1-2H3,(H,30,31,33,34) |
| InChIKey | AYRSMICDOYNWRA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|