C25H25F2N7 — CID 19903787
5-[2-[[4-[[5-but-1-ynyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole (PubChem CID 19903787) has the molecular formula C25H25F2N7 and a molecular weight of 461.52 g/mol. Its IUPAC name is 5-[2-[[4-[[5-but-1-ynyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[[4-[[5-but-1-ynyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19903787 |
| Molecular Formula | C25H25F2N7 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 5-[2-[[4-[[5-but-1-ynyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]methyl]phenyl]-2H-tetrazole |
| SMILES | CCC#Cc1nc(C(F)(F)CCC)nn1Cc1ccc(Cc2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H25F2N7/c1-3-5-10-22-28-24(25(26,27)15-4-2)31-34(22)17-19-13-11-18(12-14-19)16-20-8-6-7-9-21(20)23-29-32-33-30-23/h6-9,11-14H,3-4,15-17H2,1-2H3,(H,29,30,32,33) |
| InChIKey | SOOWQSOBPPCJAL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|