C23H28N8O2 — CID 19976162
4-[4-[[3-(1,1-dimethoxypropyl)-5-propyl-1,2,4-triazol-1-yl]methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine (PubChem CID 19976162) has the molecular formula C23H28N8O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-[4-[[3-(1,1-dimethoxypropyl)-5-propyl-1,2,4-triazol-1-yl]methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine.
| Compound Name | 4-[4-[[3-(1,1-dimethoxypropyl)-5-propyl-1,2,4-triazol-1-yl]methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 19976162 |
| Molecular Formula | C23H28N8O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 4-[4-[[3-(1,1-dimethoxypropyl)-5-propyl-1,2,4-triazol-1-yl]methyl]phenyl]-3-(2H-tetrazol-5-yl)pyridine |
| SMILES | CCCc1nc(C(CC)(OC)OC)nn1Cc1ccc(-c2ccncc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C23H28N8O2/c1-5-7-20-25-22(23(6-2,32-3)33-4)28-31(20)15-16-8-10-17(11-9-16)18-12-13-24-14-19(18)21-26-29-30-27-21/h8-14H,5-7,15H2,1-4H3,(H,26,27,29,30) |
| InChIKey | MDCKXLDIGIUFCU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|