C24H30N4O4 — CID 139879269
4-[4-[[5-butyl-3-(1,1-dimethoxypropyl)-1,2,4-triazol-1-yl]methyl]phenyl]pyridine-3-carboxylic acid (PubChem CID 139879269) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[4-[[5-butyl-3-(1,1-dimethoxypropyl)-1,2,4-triazol-1-yl]methyl]phenyl]pyridine-3-carboxylic acid.
| Compound Name | 4-[4-[[5-butyl-3-(1,1-dimethoxypropyl)-1,2,4-triazol-1-yl]methyl]phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 139879269 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 4-[4-[[5-butyl-3-(1,1-dimethoxypropyl)-1,2,4-triazol-1-yl]methyl]phenyl]pyridine-3-carboxylic acid |
| SMILES | CCCCc1nc(C(CC)(OC)OC)nn1Cc1ccc(-c2ccncc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H30N4O4/c1-5-7-8-21-26-23(24(6-2,31-3)32-4)27-28(21)16-17-9-11-18(12-10-17)19-13-14-25-15-20(19)22(29)30/h9-15H,5-8,16H2,1-4H3,(H,29,30) |
| InChIKey | PLBDIXHQARZYBW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|