C25H32N4O2 — CID 139879133
4-[4-[[3-(3-methylbutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]phenyl]pyridine-3-carboxylic acid (PubChem CID 139879133) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 4-[4-[[3-(3-methylbutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]phenyl]pyridine-3-carboxylic acid.
| Compound Name | 4-[4-[[3-(3-methylbutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 139879133 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 4-[4-[[3-(3-methylbutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]phenyl]pyridine-3-carboxylic acid |
| SMILES | CCCCCc1nc(CCC(C)C)nn1Cc1ccc(-c2ccncc2C(=O)O)cc1 |
| InChI | InChI=1S/C25H32N4O2/c1-4-5-6-7-24-27-23(13-8-18(2)3)28-29(24)17-19-9-11-20(12-10-19)21-14-15-26-16-22(21)25(30)31/h9-12,14-16,18H,4-8,13,17H2,1-3H3,(H,30,31) |
| InChIKey | SXZWJVCBCPRDPM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|