C25H32N4O5 — CID 67751153
[4-[4-[[5-butyl-3-(1,1-dimethoxybutyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pyridinyl] hydrogen carbonate (PubChem CID 67751153) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is [4-[4-[[5-butyl-3-(1,1-dimethoxybutyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pyridinyl] hydrogen carbonate.
| Compound Name | [4-[4-[[5-butyl-3-(1,1-dimethoxybutyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pyridinyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67751153 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [4-[4-[[5-butyl-3-(1,1-dimethoxybutyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pyridinyl] hydrogen carbonate |
| SMILES | CCCCc1nc(C(CCC)(OC)OC)nn1Cc1ccc(-c2ccncc2OC(=O)O)cc1 |
| InChI | InChI=1S/C25H32N4O5/c1-5-7-8-22-27-23(25(32-3,33-4)14-6-2)28-29(22)17-18-9-11-19(12-10-18)20-13-15-26-16-21(20)34-24(30)31/h9-13,15-16H,5-8,14,17H2,1-4H3,(H,30,31) |
| InChIKey | ZRZFKKKFICZYAR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|