C26H34N4O4 — CID 19976236
2-[5-[[3-(1,1-dimethoxybutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]-2-pyridinyl]benzoic acid (PubChem CID 19976236) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[5-[[3-(1,1-dimethoxybutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]-2-pyridinyl]benzoic acid.
| Compound Name | 2-[5-[[3-(1,1-dimethoxybutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 19976236 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-[5-[[3-(1,1-dimethoxybutyl)-5-pentyl-1,2,4-triazol-1-yl]methyl]-2-pyridinyl]benzoic acid |
| SMILES | CCCCCc1nc(C(CCC)(OC)OC)nn1Cc1ccc(-c2ccccc2C(=O)O)nc1 |
| InChI | InChI=1S/C26H34N4O4/c1-5-7-8-13-23-28-25(26(33-3,34-4)16-6-2)29-30(23)18-19-14-15-22(27-17-19)20-11-9-10-12-21(20)24(31)32/h9-12,14-15,17H,5-8,13,16,18H2,1-4H3,(H,31,32) |
| InChIKey | SIZKFEGHOXJXAJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|