C25H32N4O4 — CID 18700882
2-[5-[[5-(1,1-dimethoxypropyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]-2-pyridinyl]benzoic acid (PubChem CID 18700882) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[5-[[5-(1,1-dimethoxypropyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]-2-pyridinyl]benzoic acid.
| Compound Name | 2-[5-[[5-(1,1-dimethoxypropyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 18700882 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-[5-[[5-(1,1-dimethoxypropyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]-2-pyridinyl]benzoic acid |
| SMILES | CCCCCn1nc(C(CC)(OC)OC)nc1Cc1ccc(-c2ccccc2C(=O)O)nc1 |
| InChI | InChI=1S/C25H32N4O4/c1-5-7-10-15-29-22(27-24(28-29)25(6-2,32-3)33-4)16-18-13-14-21(26-17-18)19-11-8-9-12-20(19)23(30)31/h8-9,11-14,17H,5-7,10,15-16H2,1-4H3,(H,30,31) |
| InChIKey | KWZJPZRTLASSRG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|