C27H31N3O4 — CID 19750525
2-[4-[[2-but-2-ynyl-5-(1,1-dimethoxypentyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid (PubChem CID 19750525) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-[4-[[2-but-2-ynyl-5-(1,1-dimethoxypentyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-but-2-ynyl-5-(1,1-dimethoxypentyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19750525 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-[4-[[2-but-2-ynyl-5-(1,1-dimethoxypentyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
| SMILES | CC#CCn1nc(C(CCCC)(OC)OC)nc1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H31N3O4/c1-5-7-17-27(33-3,34-4)26-28-24(30(29-26)18-8-6-2)19-20-13-15-21(16-14-20)22-11-9-10-12-23(22)25(31)32/h9-16H,5,7,17-19H2,1-4H3,(H,31,32) |
| InChIKey | FTFLRXLUIHFSAL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|