C23H28N4O4 — CID 19976872
2-[6-[[3-(1,1-dimethoxypropyl)-5-propyl-1,2,4-triazol-1-yl]methyl]-3-pyridinyl]benzoic acid (PubChem CID 19976872) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-[6-[[3-(1,1-dimethoxypropyl)-5-propyl-1,2,4-triazol-1-yl]methyl]-3-pyridinyl]benzoic acid.
| Compound Name | 2-[6-[[3-(1,1-dimethoxypropyl)-5-propyl-1,2,4-triazol-1-yl]methyl]-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 19976872 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-[6-[[3-(1,1-dimethoxypropyl)-5-propyl-1,2,4-triazol-1-yl]methyl]-3-pyridinyl]benzoic acid |
| SMILES | CCCc1nc(C(CC)(OC)OC)nn1Cc1ccc(-c2ccccc2C(=O)O)cn1 |
| InChI | InChI=1S/C23H28N4O4/c1-5-9-20-25-22(23(6-2,30-3)31-4)26-27(20)15-17-13-12-16(14-24-17)18-10-7-8-11-19(18)21(28)29/h7-8,10-14H,5-6,9,15H2,1-4H3,(H,28,29) |
| InChIKey | ZDQPELKBHNIWPI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|