C25H25F2N3O2 — CID 19750480
2-[4-[[2-but-2-ynyl-5-(1,1-difluoropentyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid (PubChem CID 19750480) has the molecular formula C25H25F2N3O2 and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-[4-[[2-but-2-ynyl-5-(1,1-difluoropentyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-but-2-ynyl-5-(1,1-difluoropentyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19750480 |
| Molecular Formula | C25H25F2N3O2 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-[4-[[2-but-2-ynyl-5-(1,1-difluoropentyl)-1,2,4-triazol-3-yl]methyl]phenyl]benzoic acid |
| SMILES | CC#CCn1nc(C(F)(F)CCCC)nc1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C25H25F2N3O2/c1-3-5-15-25(26,27)24-28-22(30(29-24)16-6-4-2)17-18-11-13-19(14-12-18)20-9-7-8-10-21(20)23(31)32/h7-14H,3,5,15-17H2,1-2H3,(H,31,32) |
| InChIKey | AVQOFGDBEUKEDM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|