C26H33N7O2 — CID 19750681
5-[2-[4-[[5-(1,1-dimethoxypentyl)-2-propyl-1,2,4-triazol-3-yl]methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 19750681) has the molecular formula C26H33N7O2 and a molecular weight of 475.60 g/mol. Its IUPAC name is 5-[2-[4-[[5-(1,1-dimethoxypentyl)-2-propyl-1,2,4-triazol-3-yl]methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[[5-(1,1-dimethoxypentyl)-2-propyl-1,2,4-triazol-3-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 19750681 |
| Molecular Formula | C26H33N7O2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 5-[2-[4-[[5-(1,1-dimethoxypentyl)-2-propyl-1,2,4-triazol-3-yl]methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCCCC(OC)(OC)c1nc(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n(CCC)n1 |
| InChI | InChI=1S/C26H33N7O2/c1-5-7-16-26(34-3,35-4)25-27-23(33(30-25)17-6-2)18-19-12-14-20(15-13-19)21-10-8-9-11-22(21)24-28-31-32-29-24/h8-15H,5-7,16-18H2,1-4H3,(H,28,29,31,32) |
| InChIKey | ICNHYRVCXWWPSL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|